Odpowiedzi

2010-01-17T21:26:21+01:00
Do probowki z kwasem oleinowym dodaje roztwor bromu CCl4i wstrzasam. Wstrzasajac obserwuje zanikanie barwy bromu:
CH3(CH2)7CH=CH(CH2)7COOH+Br2-->CH3(CH2)7CH-CH(CH2)7COOH
| |
Br Br
to Br z kreskami ma byc pod 3 i 4 C liczac od strzałki (--->)

addycja wodoru do kwasu oleinowego przeprowadzana w obecnosci katalizatora prowadzi do powstania kwasu stearynowego:
CH3(CH2)7CH=CH(CH2)7COOH+H2-->CH3(CH2)16COOH
C17H33COOH+H2--->C17H35COOH
12 2 12