Odpowiedzi

2012-04-24T23:43:18+02:00

CH3-CH2-CH2-COOH(kwas masłowy{kw. butanowy}) + CH3-CH2OH(alkohol etylowy{etanol}) -->(strzałki w dwie strony a nad strzałką H2SO4 {ewentualnie H+} ) CH3-CH2-CH2-C(=O)-O-CH2-CH3 (maślan etylu) + H2O 

 

(=O) - podstawnik 

{jest to ester ma wiązanie estrowe [-COO-] }

1 5 1